| Cas No.: | 163047-21-0 |
| SMILES: | C1(O)C(O)C(OC2OC(CO)C(O)C(O)C2O)C(OC2CCC3(C)C4CCC5(C)C6C(C)C(O)(CCC(C)C)OC6C(O)C5C4CCC3C2)OC1CO |
| Formula: | C39H66O14 |
| M.Wt: | 758.93 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | In Vitro Six steroidal saponins are isolated from Anemarrhena asphodeloides Bunge (Liliaceae), a traditional chinese medicine, and named Anemarrhenasaponin I (An-I), Anemarrhenasaponin Ia (An-Ia), Timosaponin B-I (TB-I), Timosaponin B-II (TB-II), Timosaponin B-III (TB-III), and Timosaponin A-III (TA-III). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
