| Cas No.: | 1822358-25-7 |
| Chemical Name: | 2-((3S,5R)-3,5-dimethylpiperazin-1-yl)benzo[4,5]imidazo[1,2-a][1,8]naphthyridine-6-carbonitrile |
| SMILES: | N12C3=CC=CC=C3N=C1C(C#N)=CC1=C2N=C(N2C[C@H](C)N[C@H](C)C2)C=C1 |
| Formula: | C21H20N6 |
| M.Wt: | 356.42 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | POL1-IN-1 is a RNA polymerase 1 (POL1, also known as Pol I) inhibitor with an IC50 of less than 0.5 uM. POL1-IN-1 inhibits ribosome biogenesis by inhibiting POL1 transcription[1]. |
| References: | [1]. Mustapha Haddach. Compositions, uses and methods for making them. US9758518B2. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
