| Cas No.: | 2166487-21-2 |
| SMILES: | O=S(N[C@@H](CCCCNC(NCCC(O)=O)=S)C(N[C@H](C(NC1CCC1)=O)CC2=CNC3=CC=CC=C23)=O)(C4=CC(F)=CC=C4)=O |
| Formula: | C31H39FN6O6S2 |
| M.Wt: | 674.81 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | In Vitro SIRT5 inhibitor (compound 49) is a very potent Human Sirtuin 5 deacylase inhibitor, with an IC50 of 0.11 μM, >100-fold from compound 1. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
