| Cas No.: | 1076196-38-7 |
| Chemical Name: | 2-(4-Aminophenoxy)-N,N,N-trimethylethanaminium bromide hydrobromide |
| Synonyms: | 2-(4-Aminophenoxy)-N,N,N-trimethylethanaminium bromide hydrobromide;4-[2-(Trimethylammonio)ethoxy]anilinium dibromide;AK166950;2-(4-aminophenoxy)ethyl-trimethylazanium;bromide;hydrobromide;CID 91759518;4-APC (hydrobromide);APC, 4-;BTB19638;C71290;A895413;2-(4-AMINOPHENOXY)-N,N,N-TRIMETHYLETHANAMINIUM BROMIDE HBR |
| SMILES: | Br[H].[Br-].O(C1C([H])=C([H])C(=C([H])C=1[H])N([H])[H])C([H])([H])C([H])([H])[N+](C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] |
| Formula: | C11H20Br2N2O |
| M.Wt: | 356.0973 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
