| Cas No.: | 930478-88-9 |
| Chemical Name: | N-(3-Chloro-2-methylphenyl)quinoxaline-2-carboxamide |
| Synonyms: | N-(3-chloro-2-methylphenyl)quinoxaline-2-carboxamide;4i;BDBM50417141;BC600804;Z73233090;N-(3-chloro-2-methylphenyl) quinoxalin-2-carboxamide;N-(3-Chloro-2-methylphenyl)-2-quinoxalinecarboxamide (ACI) |
| SMILES: | O=C(C1C=NC2C(=CC=CC=2)N=1)NC1C(C)=C(Cl)C=CC=1 |
| Formula: | C16H12ClN3O |
| M.Wt: | 297.738982200623 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
