| Cas No.: | 91809-67-5 |
| Synonyms: | 6-Carboxytetramethylrhodamine |
| SMILES: | CN(C1=CC2=[O+]C3=C(C=CC(N(C)C)=C3)C(C4=CC(C([O-])=O)=CC=C4C(O)=O)=C2C=C1)C |
| Formula: | C25H22N2O5 |
| M.Wt: | 430.4526 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Tetramethylrhodamine (TMR, TRITC) has been a widely used fluorophore for preparing bioconjugates, especially fluorescent antibody and avidin derivatives used in immunochemistry. Under the name TAMRA, the carboxylic acid of 6-TAMRA has also achieved prominence as a dye for oligonucleotide labeling and automated DNA sequencing applications. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
