| Cas No.: | 2010154-82-0 |
| Chemical Name: | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(2-(8-oxa3-azabicyclo[3.2.1]octan-3-yl)-4-chlorobenzyl)piperazine-1-carboxylate |
| Synonyms: | ABD1970;ABD 1970 |
| SMILES: | N(C(OC(C(F)(F)F)C(F)(F)F)=O)1CCN(CC2=CC=C(Cl)C=C2N2CC3OC(CC3)C2)CC1 |
| Formula: | C21H24ClF6N3O3 |
| M.Wt: | 515.881 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | ABD-1970 (ABD1970) is a highly potent, selective Monoacylglycerol lipase (MGLL) inhibitor with IC50 of 13 nM (human MGLL); ABD-1970 robustly elevated brain 2-AG content and displayed antinociceptive and anti-pruritic activity in a battery of rodent models (ED50 values of 1-2 mg/kg; ABD-1970 also blocked 2-AG hydrolysis in human brain tissue and elevated 2-AG content in human blood without affecting stimulated prostanoid production. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
