| Cas No.: | 26328-11-0 |
| Chemical Name: | S(-)-PINDOLOL |
| Synonyms: | S(-)-PINDOLOL;(S)-(-)-PINDOLOL;S(–)-Pindolol;(-)-(S)-pindolol;(-)-pindolol;(S)-pindolol;[125I]-(-)-Pindolol;< S> -(-)-pindolol;AC1LELBQ;CHEBI:48281;S(?)-Pindolol;Tocris-1060 |
| SMILES: | CC(C)NC[C@H](O)COC1C2=C(C=CC=1)NC=C2 |
| Formula: | C14H20N2O2 |
| M.Wt: | 248.3208 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
