| Cas No.: | 2374122-37-7 |
| Chemical Name: | A 410099.1, amine-Boc hydrochloride |
| SMILES: | O=C(N(C[C@H]1N)[C@@H](C1)C(N[C@H]2C3=CC=CC=C3CCC2)=O)[C@H](C4CCCCC4)NC([C@H](C)N(C)C(OC(C)(C)C)=O)=O.Cl |
| Formula: | C32H50ClN5O5 |
| M.Wt: | 620.22 |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
