| Cas No.: | 2415256-16-3 |
| Chemical Name: | A 410099.1 amide-PEG2-amine-Boc |
| SMILES: | O=C(N(C[C@H]1NC(COCCOCCN)=O)[C@@H](C1)C(N[C@H]2C3=CC=CC=C3CCC2)=O)[C@H](C4CCCCC4)NC([C@H](C)N(C)C(OC(C)(C)C)=O)=O |
| Formula: | C38H60N6O8 |
| M.Wt: | 728.92 |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
