| Cas No.: | 173352-39-1 |
| Chemical Name: | Fabomotizole HCl |
| Synonyms: | Afobazol HCl, Afobazol Hydrochloride; CM-346; CM346; CM 346; Fabomotizole; Afobazole; |
| SMILES: | CCOC1=CC=C2NC(SCCN3CCOCC3)=NC2=C1.[H]Cl |
| Formula: | C15H22ClN3O2S |
| M.Wt: | 343.87 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Afobazol HCl(CM346 HCl) is an anxiolytic drug; produces anxiolytic and neuroprotective effects without any sedative or muscle relaxant actions.anxiolytic agent Afobazole's mechanism of action remains poorly defined however, with GABAergic, NGF and BDNF release promoting, MT1 receptor antagonism, MT3 receptor antagonism, and sigma agonism suggested as potential mechanisms. Afobazole was shown to inhibit MAO-A reversibly and there might be also some involvement with serotonin receptors. Afobazole has found little clinical use outside of Russia and has not been evaluated by the FDA. |
| References: | [1]. Afobazole, From Wikipedia |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
