| Cas No.: | 1532534-68-1 |
| Chemical Name: | 1-(5-hexyl-2,4-dihydroxyphenyl)-2-(4-isopropylphenoxy)ethan-1-one |
| SMILES: | C(C1=CC(CCCCCC)=C(O)C=C1O)(=O)COC1=CC=C(C(C)C)C=C1 |
| Formula: | C23H30O4 |
| M.Wt: | 370.489 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | AgrA inhibitor F19 is a small-molecule AgrA inhibitor that act as antivirulence agent against Gram-positive pathogens, blocks staphylococcal transcription factor AgrA from binding to its promoter and inhibits toxin and virulence factor transcription; binds to C-terminal DNA-binding domain (AgrA_C) from Staphylococcus epidermidis with an affinity of 2.7 uM, potentiates β-lactam antibiotics in a MRSA wound model. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
