| Cas No.: | 596108-59-7 |
| Synonyms: | Aminopeptidase N Inhibitor;AP-N Inhibitor |
| SMILES: | O=C(O)CC1=C2C(C(C([N+]([O-])=O)=C(C3=C([N+]([O-])=O)C=CC=C3)O2)=O)=CC=C1 |
| Formula: | C17H10N2O8 |
| M.Wt: | 370.3 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Aminopeptidase N (AP-N) inhibitor is a reversible inhibitor of AP-N/CD13 (IC50 = 25 μM).It is selective for AP-N/CD13 over matrix metalloproteinase-9 (MMP-9), angiotensin converting enzyme (ACE), neutral endopeptidase (NEP), γ-glutamyl transpeptidase, and the serine proteases dipeptidyl peptidase 4 (DPP-4) and cathepsin G at a concentration of 1 mM. AP-N inhibitor is non-cytotoxic to U937 cells at a concentration of 100 μM. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
