| Cas No.: | 2241732-30-7 |
| Chemical Name: | N-(3-((6-(4-morpholinophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy)phenyl)acrylamide |
| Synonyms: | BTK 030;BTK030 |
| SMILES: | C1=CC(NC(=O)C=C)=CC(OC2=NC=NC3NC(C4=CC=C(N5CCOCC5)C=C4)=CC2=3)=C1 |
| Formula: | C25H23N5O3 |
| M.Wt: | 441.491 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
