| Cas No.: | 1629729-98-1 |
| Chemical Name: | CHDI-390576 |
| Synonyms: | 2-(2-Fluorophenyl)-N-hydroxy-2-(4-(5-(trifluoromethyl)pyrimidin-2-yl)phenyl)acetamide;2-(2-fluorophenyl)-N-hydroxy-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]phenyl]acetamide;CHDI 00390576;2-(2-Fluorophenyl)-N-hydroxy-2-{4-[5-(trifluoromethyl)-2-pyrimidinyl]phenyl}acetamide;CHDI-390576;CS-0078811;CHEMBL4456445;SCHEMBL16112368;MS-26522;G16712;LMGDHGQJJLEAPQ-UHFFFAOYSA-N;AKOS040741544;HY-119939;1629729-98-1;DA-72141;BDBM50503690;GLXC-20273 |
| SMILES: | FC1C=CC=CC=1C(C(NO)=O)C1C=CC(C2N=CC(C(F)(F)F)=CN=2)=CC=1 |
| Formula: | C19H13F4N3O2 |
| M.Wt: | 391.319038152695 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | CHDI-390576 (CHDI390576) is a potent, cell permeable and CNS penetrant class IIa HDAC inhibitor with IC50 of 54/60/31/50 nM for HDAC4/5/7/9, respectively; displays >500-fold selectivity over class I HDAC/1/2/3 and 150-fold selectivity over HDAC8 and the class IIb HDAC6; CHDI-390576 was well-tolerated and showed no significant effect on passive observations, responses to manipulations, body weight, or body temperature in PK studies. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
