| Cas No.: | 103429-31-8 |
| Chemical Name: | Phe-Cys-Tyr-Trp-{Orn}-Thr-{Pen}-Thr-NH2 (Disulfide bridge:Cys2-Pen7) |
| Synonyms: | FCYW{Orn}T{Pen}T-NH2 (Disulfide bridge:Cys2-Pen7) |
| SMILES: | CC(C1C(=O)NC(C(SSCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CCCN)CC2=CNC3=CC=CC=C32)CC4=CC=C(C=C4)O)NC(=O)C(CC5=CC=CC=C5)N)(C)C)C(=O)NC(C(C)O)C(=O)N)O |
| Formula: | C50H67N11O11S2 |
| M.Wt: | 1062.3 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks4°C in DMSO,6 months-80°C in DMSO |
| Description: | CTOP is a potent and highly selective μ-opioid receptor antagonist. CTOP antagonizes the acute morphine-induced analgesic effect and hypermotility. CTOP enhances extracellular dopamine levels in the nucleus accumbens. CTOP dose-dependently enhances locomotor activity. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
