| Cas No.: | 1213669-91-0 |
| Chemical Name: | 3-(2,5-difluorophenyl)-6-((1-methyl-1H-1,2,4-triazol-5-yl)methoxy)-7-(2-(methyl-d3)propan-2-yl-1,1,1,3,3,3-d6)-[1,2,4]triazolo[4,3-b]pyridazine |
| Synonyms: | CTP354; CTP-354; CTP 354; C-21191; C 21191; C21191. |
| SMILES: | CN1N=CN=C1COC2=NN3C(C=C2C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])=NN=C3C4=CC(F)=CC=C4F |
| Formula: | C19H10D9F2N7O |
| M.Wt: | 408.46072 |
| Purity: | >98% |
| Sotrage: | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
