| Cas No.: | 958001-92-8 |
| Synonyms: | Ac-DNLD-AMC;Caspase-3 Substrate;Ac-Asp-Asn-Leu-Asp-MCA |
| SMILES: | CC(C1=CC=C(C=C1O2)NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CC(O)=O)NC(C)=O)=O)CC(N)=O)=O)CC(C)C)=O)CC(O)=O)=O)=CC2=O |
| Formula: | C30H38N6O12 |
| M.Wt: | 674.7 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Ac-DNLD-AMC is a fluorogenic caspase-3 substrate.Upon enzymatic cleavage by caspase-3, 7-amino-4-methylcoumarin (AMC) is released and its fluorescence can be used to quantify caspase-3 activity. AMC displays excitation/emission maxima of 340-360 and 440-460 nm, respectively. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
