| Cas No.: | 1445830-39-6 |
| Chemical Name: | 2-[1-(4-ethoxy-2,6-difluorobenzyl)-5-methoxy-4-methyl-1H-pyrazol-3-yl]-5-methoxy-N-(pyridin-4-yl)pyrimidin-4-amine |
| Synonyms: | BAY524 |
| SMILES: | C(C1C(C)=C(OC)N(CC2=C(F)C=C(OCC)C=C2F)N=1)1=NC=C(OC)C(NC2C=CN=CC=2)=N1 |
| Formula: | C24H24F2N6O3 |
| M.Wt: | 482.492 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | BAY-524 (BAY524) is a potent, selective, ATP-competitive inhibitor of Bub1 kinase with IC50 of 450 nM; reduces T120 phosphorylation of histone H2A in intact cells, affects chromosome association of Shugoshin proteins and the chromosomal passenger complex (CPC), without abolishing global Aurora B function, impairs chromosome arm resolution with minor effects on mitotic progression or SAC function; sensitizes cells to Paclitaxel, impairing both chromosome segregation and cell proliferation. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
