| Cas No.: | 74209-34-0 |
| Chemical Name: | 3-bromo-7-nitro-1H-indazole |
| SMILES: | N1C2=C(C=CC=C2[N+]([O-])=O)C(Br)=N1 |
| Formula: | C7H4BrN3O2 |
| M.Wt: | 242.032 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | 3-Bromo-7-Nitroindazole is a more potent inhibitor of nNOS than 7-nitroindazole in vitro, is also potent against iNOS, inhibits rat nNOS, bovine eNOS, and rat iNOS with IC50 of 0.17, 0.86, and 0.29 uM. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
