| Cas No.: | 173932-75-7 |
| Chemical Name: | (Z)-4-((1S,3aR,5S,12aS)-9-((E)-3,7-dimethylocta-2,6-dien-1-yl)-8,10-dihydroxy-2,2-dimethyl-11-(3-methylbut-2-en-1-yl)-4,7-dioxo-1,2,5,7-tetrahydro-1,5-methanofuro[2,3-d]xanthen-3a(4H)-yl)-2-methylbut-2-enoic acid |
| Synonyms: | GNA |
| SMILES: | C(O)(=O)/C(/C)=C\C[C@@]12OC(C)(C)[C@]([H])3C[C@@]([H])(C1=O)/C=C1\[C@@]23OC2=C(C\1=O)C(O)=C(C/C=C(\C)/CC/C=C(/C)\C)C(O)=C2C/C=C(/C)\C |
| Formula: | C38H46O8 |
| M.Wt: | 630.778 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Gambogenic acid (GNA) is a polyprenylated xanthone isolated from gamboge, shows potent antitumor activity and can effectively inhibit the survival and proliferation of cancer cells; specifically and covalently binds to Cys668 within the EZH2-SET domain, trigges EZH2 degradation (IC50=8.6 uM) through COOH terminus of Hsp70-interacting protein (CHIP)-mediated ubiquitination; synergistically potentiates bortezomib-induced apoptosis in multiple myeloma; also induces proteasomal degradation of CIP2A and sensitizes hepatocellular carcinoma to anticancer agents. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
