| Cas No.: | 2049980-18-7 |
| Chemical Name: | (2S,3R)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylpyridin-3-yl)-4H-1,2,4-triazol-3-yl]-3-(5-methylpyrimidin-2-yl)butane2-sulfonamide |
| SMILES: | C[C@@H](S(NC1N(C2=C(OC)C=CC=C2OC)C(C2=CC(C)=CN=C2)=NN=1)(=O)=O)[C@H](C1=NC=C(C)C=N1)C |
| Formula: | C25H29N7O4S |
| M.Wt: | 523.612 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | apelin receptor |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
