| Cas No.: | 2091769-17-2 |
| Chemical Name: | Pyridinium, 2-amino-1-[(phosphonooxy)methyl]-3-[3-[[4-[(2-pyridinyloxy)methyl]phenyl]methyl]-5-isoxazolyl]-, inner salt |
| SMILES: | C(N)1[N+](COP(O)([O-])=O)=CC=CC=1C1ON=C(CC2=CC=C(COC3=NC=CC=C3)C=C2)C=1 |
| Formula: | C22H21N4O6P |
| M.Wt: | 468.406 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | antifungal |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
