| Cas No.: | 16496-99-4 |
| Chemical Name: | ((1R,4aS,10aR)-7-isopropyl-1,4a-dimethyl-1,2,3,4,4a,9,10,10a-octahydrophenanthren-1-yl)methanamine hydrochloride |
| Synonyms: | Dehydroabietylamine HCl; Leelamine HCl; Leelamine hydrochloride; Leelamine; NSC-2955; NSC 2955; NSC2955; |
| SMILES: | [C@](C)(CN)1[C@@]([H])2[C@](C)(C3=C(CC2)C=C(C(C)C)C=C3)CCC1.[H]Cl |
| Formula: | C20H32ClN |
| M.Wt: | 321.933 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
