| Cas No.: | 1426153-46-9 |
| Chemical Name: | N-(4-(diethylamino)benzyl)-4-methoxy-N-(p-tolyl)benzenesulfonamide |
| Synonyms: | XL001 |
| SMILES: | C(S(N(CC1=CC=C(N(CC)CC)C=C1)C1=CC=C(C)C=C1)(=O)=O)1=CC=C(OC)C=C1 |
| Formula: | C25H30N2O3S |
| M.Wt: | 438.586 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | XL-001 (XL001) is a novel specific CB2 inverse agonist with Ki of 0.5 nM; inhibits in a dose-dependent fashion the fibrogenic response induced by CB2 overexpression, CB2 agonist or transforming growth factor-β1, ameliorates kidney injury, fibrosis and inflammation in both the obstruction and ischemia/reperfusion models. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
