| Cas No.: | 1809275-69-1 |
| Chemical Name: | N-(4-{(2S)-2-{(2S)-2-[(methoxycarbonyl)amino]-3-phenylpropanamido}-2-[2-(thiophen-2-yl)-1,3-thiazol-4-yl]ethyl}phenyl)sulfamic acid, sodium salt |
| SMILES: | [Na+].S(NC1=CC=C(C[C@@H](NC(=O)[C@H](NC(OC)=O)CC2=CC=CC=C2)C2=CSC(C3SC=CC=3)=N2)C=C1)([O-])(=O)=O |
| Formula: | C26H25N4NaO6S3 |
| M.Wt: | 608.68 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Razuprotafib sodium is a potent protein tyrosine phosphatase β(HPTPβ) inhibitor. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
