| Cas No.: | 1959537-86-0 |
| Chemical Name: | N-(4'-(4-hydroxy-4-((1-methyl-4-oxo-1,4-dihydro-5H-pyrazolo[3,4-d]pyrimidin-5-yl)methyl)piperidine-1-carbonyl)-[1,1'-biphenyl]-2-yl)ethenesulfonamide |
| Synonyms: | FT827;FT 827 |
| SMILES: | C(S(NC1=CC=CC=C1C1=CC=C(C(N2CCC(O)(CN3C=NC4N(C)N=CC=4C3=O)CC2)=O)C=C1)(=O)=O)=C |
| Formula: | C27H28N6O5S |
| M.Wt: | 548.618 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel potent, specific, covalent USP7 inhibitor with Kd of 7.8 uM (USP7 catalytic domain); modifies the catalytic Cys223 of USP7 and inhibits the enzyme with kinact/Ki of 66 M-1s-1, display good USP7 selectivity in a panel of 38 deubiquitinases (DUBs) |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
