| Cas No.: | 2140260-89-3 |
| Chemical Name: | N-(4-(chlorodifluoromethoxy)phenyl)-6-(3-((2-(2-(2-(3-(2-((S)-1-((S)-2-cyclohexyl-2-((S)-2-(methylamino)propanamido)acetyl)pyrrolidin-2-yl)thiazole-4-carbonyl)phenoxy)ethoxy)ethoxy)ethyl)carbamoyl)pyrrolidin-1-yl)-5-(1H-pyrazol-5-yl)nicotinamide |
| Synonyms: | SNIPER ABL 062 |
| SMILES: | C(NC1=CC=C(OC(Cl)(F)F)C=C1)(=O)C1=CN=C(N2CCC(C(=O)NCCOCCOCCOC3=CC=CC(C(C4=CSC([C@H]5CCCN5C([C@@H](C5CCCCC5)NC(=O)[C@H](NC)C)=O)=N4)=O)=C3)C2)C(C2NN=CC=2)=C1 |
| Formula: | C53H63ClF2N10O9S |
| M.Wt: | 1089.655 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | SNIPER(ABL)-062 is a novel, potent SNIPER molecule that tethers BCR-ABL inhibitor to a ligand of IAP, causes potent BCR-ABL degradation; shows desirable binding affinities against ABL1, cIAP1/2, and XIAP (IC50=80-500 nM), inhibits BCR-ABL-mediated signaling pathways and CML proliferation in cells expressing BCR-ABL. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
