| Cas No.: | 2170679-45-3 |
| Chemical Name: | 2-((2,6-dimethoxy-4-(2-methyl-1-oxo-1,2-dihydro-2,7-naphthyridin-4-yl)benzyl)(methyl)amino)-N-(2-(2-(2-((2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)amino)ethoxy)ethoxy)ethyl)acetamide |
| Synonyms: | dBRD 9 |
| SMILES: | C(NCCOCCOCCNC1=CC=CC2=C1C(=O)N(C1CCC(=O)NC1=O)C2=O)(=O)CN(CC1=C(OC)C=C(C2C3C(C(=O)N(C)C=2)=CN=CC=3)C=C1OC)C |
| Formula: | C40H45N7O10 |
| M.Wt: | 783.839 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | dBRD9 is a PROTAC that bridge the BRD9 bromodomain and the cereblon E3 ubiquitin ligase complex; exhibits markedly enhanced potency compared to parental ligands (10-100 fold). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
