| Cas No.: | 1316652-41-1 |
| Chemical Name: | N-hydroxy-3-(1-((phenylthio)methyl)-1H-1,2,3-triazol-4-yl)benzamide |
| Synonyms: | NCC 149;NCC149 |
| SMILES: | C(NO)(=O)C1=CC=CC(C2=CN(CSC3=CC=CC=C3)N=N2)=C1 |
| Formula: | C16H14N4O2S |
| M.Wt: | 326.374 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent and selective HDAC8 inhibitor with IC50 of 70 nM; displays high selectivity over major HDACs (HDAC1: IC50 38 uM, HDAC2 >100 uM, HDAC4: IC50: 44 uM,HDAC6: IC50 2.4 uM). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
