| Cas No.: | 1971075-99-6 |
| Chemical Name: | (6aS,6a'S)-3,3'-(propane-1,3-diylbis(oxy))bis(2-methoxy-7,12-dihydrobenzo[5,6][1,4]diazepino[1,2-b]isoquinolin-14(6aH)-one) |
| Synonyms: | (S,S)-D211;D-211 |
| SMILES: | C(OC1C=C2C(=CC=1OC)C(=O)N1[C@@]([H])(C=N2)CC2=C(C1)C=CC=C2)CCOC1C=C2C(=CC=1OC)C(=O)N1[C@@]([H])(C=N2)CC2=C(C1)C=CC=C2 |
| Formula: | C39H36N4O6 |
| M.Wt: | 656.739 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel potent DNA-intercalating payload dimer (PBD dimer) payload for antibody-drug conjugates (ADCs); displays picomolar potency against AML cancer cell lines. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
