| Cas No.: | 1222490-34-7 |
| Chemical Name: | (S)-2-(4-aminophenyl)-7-methoxy-8-(3-(((S)-7-methoxy-2-(4-methoxyphenyl)-5-oxo-5,11a-dihydro-1H-benzo[e]pyrrolo[1,2-a][1,4]diazepin-8-yl)oxy)propoxy)-1,11a-dihydro-5H-benzo[e]pyrrolo[1,2-a][1,4]diazepin-5-one |
| Synonyms: | PBD dimer;Pyrrolobenzodiazepine dimer |
| SMILES: | O=C(C1=CC(OC)=C(OCCCOC(C=C(N=C[C@@]2([H])N(C=C(C3=CC=C(N)C=C3)C2)C4=O)C4=C5)=C5OC)C=C1N=C6)N7[C@@]6([H])CC(C8=CC=C(OC)C=C8)=C7 |
| Formula: | C42H39N5O7 |
| M.Wt: | 725.79 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | SGD-1882 (PBD dimer, Pyrrolobenzodiazepine dimer) is a novel potent DNA-intercalating payload dimer (PBD dimer) payload for antibody-drug conjugates (ADCs). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
