| Cas No.: | 2097508-70-6 |
| Chemical Name: | 6-(3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-2-oxoindolin-1-yl)-1,3,3-trimethyl-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one |
| Synonyms: | ENT-1 inhibitor |
| SMILES: | C12N(C)C(=O)C(C)(C)C1=CC=C(N1C3=C(C=CC(C4=CN=C(C)N=C4)=C3)C(C)(C)C1=O)N=2 |
| Formula: | C25H25N5O2 |
| M.Wt: | 427.508 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent adenosine transport activity of ENT-1 with IC50 of 26.9 nM; displays ENT1 inhibition and efficacy in L-687414-induced hyperlocomotion mouse model (99.5 inhibition at 30 mg/kg, i.p.) |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
