| Cas No.: | 1243184-62-4 |
| Chemical Name: | (((5-(5-oxo-4,5-dihydroisoxazol-3-yl)furan-2-yl)phosphoryl)bis(oxy))bis(methylene) bis(2-methylpropanoate) |
| SMILES: | P(OCOC(=O)C(C)C)(OCOC(=O)C(C)C)(C1=CC=C(C2CC(=O)ON=2)O1)=O |
| Formula: | C17H22NO10P |
| M.Wt: | 431.334 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, allosteric, α1-selective small molecule activator of AMPK (EC50=20 nM); inhibits de novo lipogenesis in cellular and animal models of hyperlipidemia; the cell-permeable prodrug of compound 2 (AMPK-Activator-2). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
