| Cas No.: | 457893-92-4 |
| Chemical Name: | 1-[1-(3-Methyl-L-histidyl-O-methyl-D-tyrosyl)-4-phenyl-4-piperidinyl]-1-butanone dihydrochloride |
| Synonyms: | BMS 470539;BMS470539 |
| SMILES: | C(C(C1=CC=CC=C1)1CCN(C(=O)[C@H](CC2C=CC(OC)=C(C)C=2)NC(=O)[C@@H](CC2N=CNC=2)N)CC1)(=O)CCC.[H]Cl.[H]Cl |
| Formula: | C32H41N5O4.2HCl |
| M.Wt: | 632.62 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective, full agonist of human and murine MC1R with EC50 of 16.8 and 11.6 nM, respectively; dose-dependently inhibits TNFα-induced activation of a NF-kappaB transcriptional reporter in human melanoma cells; inhibits LPS-induced TNFα production in BALB/c mice (EC50=10 uM/kg); inhibits leucocyte trafficking in the inflamed vasculature. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
