| Cas No.: | 2139287-33-3 |
| Chemical Name: | N-(5-(((5-(tert-butyl)oxazol-2-yl)methyl)thio)thiazol-2-yl)-1-(14-((2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)amino)-2-oxo-6,9,12-trioxa-3-azatetradecyl)piperidine-4-carboxamide |
| Synonyms: | THAL SNS 032;CDK9 PROTAC degrader |
| SMILES: | N(CC(=O)NCCOCCOCCOCCNC1=CC=CC2=C1C(=O)N(C1CCC(=O)NC1=O)C2=O)1CCC(C(NC2=NC=C(SCC3=NC=C(C(C)(C)C)O3)S2)=O)CC1 |
| Formula: | C40H52N8O10S2 |
| M.Wt: | 869.022 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | THAL-SNS-032 is a selective CDK9 degrader PROTAC consisting of a CDK-binding SNS-032 ligand linked to a thalidomide derivative that binds the E3 ubiquitin ligase Cereblon (CRBN)[1]. |
| Target: | CDK9[1] |
| In Vitro: | THAL-SNS-032 selectively induces degradation of CDK9[1]. THAL-SNS-032 diminishes elongating polymerase II[1]. THAL-SNS-032 inhibits proliferation of MOLT4 cells with an IC50 of 50 nM[1]. |
| References: | [1]. Olson CM,et al. Pharmacological perturbation of CDK9 using selective CDK9 inhibition or degradation. Nat Chem Biol. 2018 Feb;14(2):163-170. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
