To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2109805-83-4 |
| Chemical Name: | N-cyclohexyl-2-(4-(3,5-dimethylisoxazol-4-yl)-2-methoxyphenyl)imidazo[1,2-a]pyrazin-3-amine |
| Synonyms: | UMB136;UMB 136 |
| SMILES: | C12=NC(C3=CC=C(C4=C(C)ON=C4C)C=C3OC)=C(NC3CCCCC3)N1C=CN=C2 |
| Formula: | C24H27N5O2 |
| M.Wt: | 417.513 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel bromodomain BRD4 inhibitor that significantly induces HIV-1 reactivation; dramatically reversed HIV-1 latency at both low (2.5 uM) and high (5 uM) doses in multiple cell models of HIV-1 latency through promoting Tat-dependent transcriptional elongation and Tat-P-TEFb association; enhances the latency-reversing effects of PKC agonists (prostratin, bryostatin-1) in CD8-depleted PBMCs containing latent viral reservoirs. |