To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 1635437-39-6 |
| Chemical Name: | N-(1,1-dimethylethyl)-2-[4-(3,5-dimethyl-4-isoxazolyl)phenyl]-imidazo[1,2-a]pyrazin-3-amine |
| Synonyms: | UMB 32;UMB32 |
| SMILES: | C12=NC(C3=CC=C(C4=C(C)ON=C4C)C=C3)=C(NC(C)(C)C)N1C=CN=C2 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel a potent, selective inhibitor of BRD4 with Kd of 550 nM, cellular IC50 of 724 nM; also potently binds to the TAF1 (560 nM) and TAF1L (1.3 uM) bromodomains; significantly induces HIV-1 reactivation. |