| Cas No.: | 1124197-79-0 |
| Chemical Name: | (4-hydroxypiperidin-1-yl){5-[4-methyl-5-(trifluoromethyl)- 1,2-oxazol-3-yl]thiophen-2-yl}methanone |
| SMILES: | C(N1CCC(O)CC1)(C1SC(C2C(C)=C(C(F)(F)F)ON=2)=CC=1)=O |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent monoamine oxidase B (MAO-B) inhibitor. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
