| Cas No.: | 54403-20-2 |
| Chemical Name: | 4-(5-chloro-1-benzofuran-2-yl)-1-methylpiperidine hydrochloride |
| Synonyms: | CGP-4718A;CGP 4718A |
| SMILES: | N(C)1CCC(C2=CC3=CC(Cl)=CC=C3O2)CC1.[H]Cl |
| Formula: | C14H16NOCl.HCl |
| M.Wt: | 286.19688 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A selective, reversible inhibitor of MAO-A and serotonin reuptake inhibitor as an antidepressant. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
