| Cas No.: | 1348755-27-0 |
| Chemical Name: | N-(4-(4-(2-methoxyphenyl)piperazin-1-yl)butyl)adamantane-2-carboxamide |
| SMILES: | C12CC3CC(CC(C3)C1C(NCCCCN1CCN(C3=CC=CC=C3OC)CC1)=O)C2 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, highly selective 5-HT1A receptor partial agonist with Ki of 0.1 nM, displays 460- and 260-fold selectivity for 5-HT1A over the α1-adrenergic and D2 receptors, respectively. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
