| Cas No.: | 1454288-88-0 |
| Chemical Name: | Rovazolac |
| Synonyms: | Rovazolac;W51K389XIL;(trifluoromethyl)-1H-pyrazol-1-yl}acetate;ethyl 2-[5-[4-(3-methylsulfonylphenyl)phenyl]-3-(trifluoromethyl)pyrazol-1-yl]acetate;ethyl {5-[3'-(methanesulfonyl)[1,1'-biphenyl]-4-yl]-3-;Rovazolac [INN];GTPL9625;example 36 [WO2013130892];ethyl 2-(5-(3'-(methylsulfonyl)biphenyl-4-yl)-3-(trifluoromethyl)-1H-pyrazol-1-yl)acetate;Ethyl 2-(5-(3'-(methylsulfonyl)-(1,1'-biphenyl)-4-yl)-3-(trif |
| SMILES: | S(C)(C1C=CC=C(C=1)C1C=CC(=CC=1)C1=CC(C(F)(F)F)=NN1CC(=O)OCC)(=O)=O |
| Formula: | C21H19F3N2O4S |
| M.Wt: | 452.446774721146 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | An novel anti-inflammatory agent.. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
