| Cas No.: | 1311137-58-2 |
| Chemical Name: | 4-({5-[(4R)-4-ethyl-2,5-dioxo-1-imidazolidinyl]-2-pyridinyl}oxy)-2-(1-methylethyl)benzonitrile |
| Synonyms: | AUT-2;AUT 2 |
| SMILES: | C(#N)C1=CC=C(OC2=NC=C(N3C(=O)N[C@@H](CC)C3=O)C=C2)C=C1C(C)C |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A novel specific, cell permeant modulator of Kv3 channels with EC50 of 0.9 and 1.9 uM for Kv3.1b and Kv3.2a, respectively; is more potent than AUT1, increases open probability of Kv3.1 channels in excised membrane patches, and reduces the firing rate of auditory brain stem neurons. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
