| Cas No.: | 50743-17-4 |
| Chemical Name: | 4-Oxo-4H-1-benzopyran-3-carbonitrile |
| SMILES: | O1C2C(=CC=CC=2)C(=O)C(C#N)=C1 |
| Formula: | C10H5NO2 |
| M.Wt: | 171.15 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | 3-Cyanochromone is a potent gram-negative bacteria WcbL protein inhibitor with IC50 of 28 uM in a competitive enzyme-inhibition model, shows inhibition constants Ki of 10 uM. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
