| Cas No.: | 917773-99-0 |
| Chemical Name: | GAPDS |
| SMILES: | N(C(C1=CC=CC=C1)=O)CCOCCOCCNC1N=C(N=C(N=1)NCCC1=CC(O)=C(O)C=C1)NC1C=CC=CC=1 |
| Formula: | C30H35N7O5 |
| M.Wt: | 573.64 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | GAPDS is a small molecule that targets the glycolytic enzyme glyceraldehyde 3-phosphate dehydrogenase (GAPDH); significantly reduces cellular ATP, shows greater toxicity against cancer cells compared to 6-OHDA, also selectively inhibits cell migration and invasion; reduces GAPDH levels in the cytoplasm, and has potent anticancer activity in vivo. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
