| Cas No.: | 260443-89-8 |
| Chemical Name: | 4-(5-Fluorobenzothiazol-2-yl)-2-methylphenylamine |
| Synonyms: | 4-(5-Fluorobenzothiazol-2-yl)-2-methylphenylamine;NSC-D703786;NSC-703786;5F-DF-203;5F-203;4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methylaniline;5-Fluoro 203;4-(5-Fluoro-2-benzothiazolyl)-2-methyl-benzenamine;5F203;NCS 703786;NSC 703786 |
| SMILES: | FC1=CC2N=C(C3C=CC(N)=C(C)C=3)SC=2C=C1 |
| Formula: | C14H11FN2S |
| M.Wt: | 258.313945055008 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective antitumour agent through activation the aryl hydrocarbon receptor (AhR) pathway; causes MCF-7 sensitive cells to arrest in G(1) and S phase, and induces DNA adduct formation, in contrast to AhR-deficient AH(R100) variant MCF-7 cells, induces CYP1A1 and CYP1B1 transcription; L-lysylamide prodrug Phortress (NSC 710305) demonstrats antitumor activity in vivo. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
