| Cas No.: | 1446261-44-4 |
| Chemical Name: | Pamiparib free base |
| Synonyms: | (R)-2-fluoro-10a-methyl-7,8,9,10,10a,11-hexahydro-5,6,7a,11-tetraazacyclohepta[def]cyclopenta[a]fluoren-4(5H)-one;Pamiparib;8375F9S90C;Pamiparib [INN];Pamiparib [USAN];Pamiparib (USAN/INN);Pamiparib [USAN:INN];BGB290;DENYZIUJOTUUNY-MRXNPFEDSA-N;BCP20780;s8592;DB14769;A17073;D11426 |
| SMILES: | FC1=CC2C(NN=C3C4C=2C(=C1)NC=4[C@@]1(C)CCCN1C3)=O |
| Formula: | C16H15FN4O |
| M.Wt: | 298.321 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Pamiparib (BGB-290, BGB290) is a PARP inhibitor which can be used for the treatment of various cancers including the solid tumor, extracted from patent WO 2013097225 A1. |
| Target: | PARP |
| References: | [1]. Changyou Zhou, et al. Fused tetra or penta-cyclic dihydrodiazepinocarbazolones as parp inhibitors. WO 2013097225 A1. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
