| Cas No.: | 652973-93-8 |
| Chemical Name: | Benzamide,4-chloro-N-[(1S,2S)-2-[[(1R)-1-(1-naphthalenyl)ethyl]amino]cyclohexyl]- |
| Synonyms: | Benzamide,4-chloro-N-[(1S,2S)-2-[[(1R)-1-(1-naphthalenyl)ethyl]amino]cyclohexyl]-;Calhex 231;Calhex 231 hydrochloride;CALHEX 231,OFF-WHITE TO PALE YELLOW SOLID;4-Chloro-N-[(1S,2S)-2-[[(1R)-1-(1-naphthalenyl)ethyl]amino]cyclohexyl]benzamide |
| SMILES: | ClC1C=CC(C(NC2CCCCC2NC(C2C3C(=CC=CC=3)C=CC=2)C)=O)=CC=1 |
| Formula: | C25H27ClN2O |
| M.Wt: | 406.947685480118 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Calhex-231 is a potent negative allosteric modulator of CaSR that blocks calcium-mediated activation with IC50 of 0.39 uM. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
