| Cas No.: | 1634680-81-1 |
| Chemical Name: | 4-[2-[4-[[2-[[3-[(4-Carboxycyclohexyl)-ethylsulfamoyl]benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]phenyl]ethyl]benzoic acid |
| Synonyms: | 4-(4-(2-(3-(N-((1R,4r)-4-carboxycyclohexyl)-N-ethylsulfamoyl)benzamido)-5-(piperidin-1-yl)benzamido)phenethyl)benzoic acid;4-[2-[4-[[2-[[3-[(4-Carboxycyclohexyl)-ethylsulfamoyl]benzoyl]amino]-5-piperidin-1-ylbenzoyl]amino]p |
| SMILES: | S(C1C=CC=C(C(NC2C=CC(=CC=2C(NC2C=CC(=CC=2)CCC2C=CC(C(=O)O)=CC=2)=O)N2CCCCC2)=O)C=1)(N(CC)C1CCC(C(=O)O)CC1)(=O)=O |
| Formula: | C43H48N4O8S |
| M.Wt: | 780.928230285645 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | DS-2330 is a phosphorous lowering agent for treating hyperphosphatemia in chronic kidney disease.Other IndicationPhase 1 Clinical |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
