| Cas No.: | 1212704-51-2 |
| Chemical Name: | Jarin-1 |
| Synonyms: | Jarin-1;Biphenyl-4-carboxylic acid [3-(3-methoxy-propionyl)-8-oxo-1,3,4,5,6,8-hexahydro-2H-1,5-methano-pyrido[1,2-a][1,5]diazocin-9-yl]-amide;G13353;N-[(1R,9S)-11-(3-Methoxypropanoyl)-6-oxo-7,11-diazatricyclo[7.3.1.0,2,7]trideca-2,4-dien-5-yl]-[1,1'-biphenyl]-4-carboxamide;N-((1R,5S)-3-(3-Methoxypropanoyl)-8-oxo-1,3,4,5,6,8-hexahydro-2H-1,5-methanopyrido[1,2-a][1,5]diazocin-9-yl)-[1,1'-biphenyl]-4-carboxamide;AKOS040741892;DA-54513;MS-28721;N-[(1R,9S)-11-(3-methoxypropanoyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]-4-phenylbenzamide;1212704-51-2;HY-115521;CS-0087362;EX-A9337 |
| SMILES: | O=C1C(=CC=C2C3CN(C(CCOC)=O)CC(CN21)C3)NC(C1C=CC(C2C=CC=CC=2)=CC=1)=O |
| Formula: | C28H29N3O4 |
| M.Wt: | 471.547567129135 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Jarin-1 is the first small-molecule inhibitor of JAR1 (IC50=3.8 uM) that inhibits jasmonate responses in Arabidopsis thaliana; impairs the activity of JA-Ile synthetase, thereby preventing the synthesis of the active hormone, JA-Ile, whereas closely related enzymes are not affected; A useful chemical tool in search for missing regulatory components and further dissection of the complex jasmonate signaling networks. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
